C16H22BrF2NO2 — CID 135131765
(4R)-4-(4-bromophenyl)-6-[(3,3-difluoro-2-hydroxypropyl)amino]-2-methylhexan-3-one (PubChem CID 135131765) has the molecular formula C16H22BrF2NO2 and a molecular weight of 378.26 g/mol. Its IUPAC name is (4R)-4-(4-bromophenyl)-6-[(3,3-difluoro-2-hydroxypropyl)amino]-2-methylhexan-3-one.
| Compound Name | (4R)-4-(4-bromophenyl)-6-[(3,3-difluoro-2-hydroxypropyl)amino]-2-methylhexan-3-one |
|---|---|
| PubChem CID | 135131765 |
| Molecular Formula | C16H22BrF2NO2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (4R)-4-(4-bromophenyl)-6-[(3,3-difluoro-2-hydroxypropyl)amino]-2-methylhexan-3-one |
| SMILES | CC(C)C(=O)C(CCNCC(O)C(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H22BrF2NO2/c1-10(2)15(22)13(11-3-5-12(17)6-4-11)7-8-20-9-14(21)16(18)19/h3-6,10,13-14,16,20-21H,7-9H2,1-2H3 |
| InChIKey | IXDMOXSLBHKRGE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|