About 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine
2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 158815051) has the molecular formula C16H23F3N2
and a molecular weight of 300.37 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 158815051 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | NCCC1=CCCCC1.NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C8H8F3N.C8H15N/c9-8(10,11)7-3-1-6(5-12)2-4-7;9-7-6-8-4-2-1-3-5-8/h1-4H,5,12H2;4H,1-3,5-7,9H2 |
| InChIKey | IVDUWHCDQCMJJB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine (CID 158815051) is 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine is NCCC1=CCCCC1.NCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine?
The InChIKey is IVDUWHCDQCMJJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N.C8H15N/c9-8(10,11)7-3-1-6(5-12)2-4-7;9-7-6-8-4-2-1-3-5-8/h1-4H,5,12H2;4H,1-3,5-7,9H2.
What are the key properties of 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine?
2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine has a molecular weight of 300.37 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexen-1-yl)ethanamine;[4-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 158815051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).