About 1,4-Benzenedimethanamine
1,4-Benzenedimethanamine (PubChem CID 68315) has the molecular formula C8H12N2
and a molecular weight of 136.19 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | 1,4-Benzenedimethanamine |
| PubChem CID | 68315 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | [4-(aminomethyl)phenyl]methanamine |
| SMILES | C1=CC(=CC=C1CN)CN |
| InChI | InChI=1S/C8H12N2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6,9-10H2 |
| InChIKey | ISKQADXMHQSTHK-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | 73 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-Benzenedimethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-Benzenedimethanamine?
The IUPAC name of 1,4-Benzenedimethanamine (CID 68315) is [4-(aminomethyl)phenyl]methanamine.
What is the SMILES notation for 1,4-Benzenedimethanamine?
The canonical SMILES for 1,4-Benzenedimethanamine is C1=CC(=CC=C1CN)CN.
What is the InChIKey of 1,4-Benzenedimethanamine?
The InChIKey is ISKQADXMHQSTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6,9-10H2.
What are the key properties of 1,4-Benzenedimethanamine?
1,4-Benzenedimethanamine has a molecular weight of 136.19 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-Benzenedimethanamine is sourced from PubChem (CID 68315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).