C16H19N3O3 — CID 158815393
ethyl spiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,1'-cyclopentane]-4-carboxylate (PubChem CID 158815393) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is ethyl spiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,1'-cyclopentane]-4-carboxylate.
| Compound Name | ethyl spiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,1'-cyclopentane]-4-carboxylate |
|---|---|
| PubChem CID | 158815393 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl spiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,1'-cyclopentane]-4-carboxylate |
| SMILES | CCOC(=O)c1cnn2cc3c(nc12)CC1(CCCC1)CO3 |
| InChI | InChI=1S/C16H19N3O3/c1-2-21-15(20)11-8-17-19-9-13-12(18-14(11)19)7-16(10-22-13)5-3-4-6-16/h8-9H,2-7,10H2,1H3 |
| InChIKey | IVEXSVGJYDYZPJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |