C15H15F2N3O3 — CID 161064173
ethyl 1',1'-difluorospiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,3'-cyclobutane]-4-carboxylate (PubChem CID 161064173) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is ethyl 1',1'-difluorospiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,3'-cyclobutane]-4-carboxylate.
| Compound Name | ethyl 1',1'-difluorospiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,3'-cyclobutane]-4-carboxylate |
|---|---|
| PubChem CID | 161064173 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | ethyl 1',1'-difluorospiro[10-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene-12,3'-cyclobutane]-4-carboxylate |
| SMILES | CCOC(=O)c1cnn2cc3c(nc12)CC1(CO3)CC(F)(F)C1 |
| InChI | InChI=1S/C15H15F2N3O3/c1-2-22-13(21)9-4-18-20-5-11-10(19-12(9)20)3-14(8-23-11)6-15(16,17)7-14/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | UDUGAZDYERCALV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |