C20H31NO2 — CID 15881546
ethyl 2-(1-benzyl-2-pentylpyrrolidin-3-yl)acetate (PubChem CID 15881546) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-2-pentylpyrrolidin-3-yl)acetate.
| Compound Name | ethyl 2-(1-benzyl-2-pentylpyrrolidin-3-yl)acetate |
|---|---|
| PubChem CID | 15881546 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | ethyl 2-(1-benzyl-2-pentylpyrrolidin-3-yl)acetate |
| SMILES | CCCCCC1C(CC(=O)OCC)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H31NO2/c1-3-5-7-12-19-18(15-20(22)23-4-2)13-14-21(19)16-17-10-8-6-9-11-17/h6,8-11,18-19H,3-5,7,12-16H2,1-2H3 |
| InChIKey | RDZFZNAGNLIJKX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|