C30H53NO6S — CID 158819944
2-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-(2-methylpropyl)amino]ethanesulfonic acid (PubChem CID 158819944) has the molecular formula C30H53NO6S and a molecular weight of 555.82 g/mol. Its IUPAC name is 2-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-(2-methylpropyl)amino]ethanesulfonic acid.
| Compound Name | 2-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-(2-methylpropyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 158819944 |
| Molecular Formula | C30H53NO6S |
| Molecular Weight | 555.82 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | 2-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl-(2-methylpropyl)amino]ethanesulfonic acid |
| SMILES | CC(C)CN(CCS(=O)(=O)O)C(=O)CCC(C)C1CCC2C3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C30H53NO6S/c1-19(2)18-31(14-15-38(35,36)37)27(34)9-6-20(3)23-7-8-24-28-25(11-13-30(23,24)5)29(4)12-10-22(32)16-21(29)17-26(28)33/h19-26,28,32-33H,6-18H2,1-5H3,(H,35,36,37)/t20?,21-,22+,23?,24?,25?,26?,28?,29-,30+/m0/s1 |
| InChIKey | PRVYZZOYQWAQPL-IOENNPPPSA-N |
| XLogP | 4.77 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|