C32H55NO6S — CID 159278852
2-[cyclohexyl-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid (PubChem CID 159278852) has the molecular formula C32H55NO6S and a molecular weight of 581.86 g/mol. Its IUPAC name is 2-[cyclohexyl-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[cyclohexyl-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 159278852 |
| Molecular Formula | C32H55NO6S |
| Molecular Weight | 581.86 g/mol |
| Exact Mass | 581.38 |
| IUPAC Name | 2-[cyclohexyl-[4-[(3R,5S,10S,13R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)N(CCS(=O)(=O)O)C1CCCCC1)C1CCC2C3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C32H55NO6S/c1-21(9-12-29(36)33(17-18-40(37,38)39)23-7-5-4-6-8-23)25-10-11-26-30-27(14-16-32(25,26)3)31(2)15-13-24(34)19-22(31)20-28(30)35/h21-28,30,34-35H,4-20H2,1-3H3,(H,37,38,39)/t21?,22-,24+,25?,26?,27?,28?,30?,31-,32+/m0/s1 |
| InChIKey | XZCVOKDGJSPFSY-JWUAZOSASA-N |
| XLogP | 5.44 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|