C32H55NO5S — CID 172517926
2-[cyclohexyl-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid (PubChem CID 172517926) has the molecular formula C32H55NO5S and a molecular weight of 565.86 g/mol. Its IUPAC name is 2-[cyclohexyl-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[cyclohexyl-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 172517926 |
| Molecular Formula | C32H55NO5S |
| Molecular Weight | 565.86 g/mol |
| Exact Mass | 565.38 |
| IUPAC Name | 2-[cyclohexyl-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl]amino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)N(CCS(=O)(=O)O)C1CCCCC1)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C32H55NO5S/c1-22(9-14-30(35)33(19-20-39(36,37)38)24-7-5-4-6-8-24)27-12-13-28-26-11-10-23-21-25(34)15-17-31(23,2)29(26)16-18-32(27,28)3/h22-29,34H,4-21H2,1-3H3,(H,36,37,38) |
| InChIKey | MRTFNVVWPWJGNL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|