C27H47NO5S — CID 75180851
2-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-methylamino]ethanesulfonic acid (PubChem CID 75180851) has the molecular formula C27H47NO5S and a molecular weight of 497.74 g/mol. Its IUPAC name is 2-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-methylamino]ethanesulfonic acid.
| Compound Name | 2-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 75180851 |
| Molecular Formula | C27H47NO5S |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.32 |
| IUPAC Name | 2-[4-(3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl-methylamino]ethanesulfonic acid |
| SMILES | CC(CCC(=O)N(C)CCS(=O)(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H47NO5S/c1-18(5-10-25(30)28(4)15-16-34(31,32)33)22-8-9-23-21-7-6-19-17-20(29)11-13-26(19,2)24(21)12-14-27(22,23)3/h18-24,29H,5-17H2,1-4H3,(H,31,32,33) |
| InChIKey | MFDHSRQWKNAICJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|