C28H32N6O6 — CID 158822034
tert-butyl 4-(4-aminophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate (PubChem CID 158822034) has the molecular formula C28H32N6O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is tert-butyl 4-(4-aminophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-(4-aminophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 158822034 |
| Molecular Formula | C28H32N6O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | tert-butyl 4-(4-aminophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccc(N)cc2)cn1.CC(C)(C)OC(=O)n1cc(-c2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C14H15N3O4.C14H17N3O2/c1-14(2,3)21-13(18)16-9-11(8-15-16)10-4-6-12(7-5-10)17(19)20;1-14(2,3)19-13(18)17-9-11(8-16-17)10-4-6-12(15)7-5-10/h4-9H,1-3H3;4-9H,15H2,1-3H3 |
| InChIKey | IVZKYHPFNMHJNU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 157.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|