C28H36N4O6 — CID 23134426
tert-butyl 5-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]phenyl]-4-nitroindazole-1-carboxylate (PubChem CID 23134426) has the molecular formula C28H36N4O6 and a molecular weight of 524.62 g/mol. Its IUPAC name is tert-butyl 5-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]phenyl]-4-nitroindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]phenyl]-4-nitroindazole-1-carboxylate |
|---|---|
| PubChem CID | 23134426 |
| Molecular Formula | C28H36N4O6 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | tert-butyl 5-[4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl]phenyl]-4-nitroindazole-1-carboxylate |
| SMILES | CCC(CC)(NC(=O)OC(C)(C)C)c1ccc(-c2ccc3c(cnn3C(=O)OC(C)(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H36N4O6/c1-9-28(10-2,30-24(33)37-26(3,4)5)19-13-11-18(12-14-19)20-15-16-22-21(23(20)32(35)36)17-29-31(22)25(34)38-27(6,7)8/h11-17H,9-10H2,1-8H3,(H,30,33) |
| InChIKey | DJIQIKKIBMQZTB-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|