C24H28N4O6 — CID 23134605
tert-butyl 5-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-4-nitroindazole-1-carboxylate (PubChem CID 23134605) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is tert-butyl 5-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-4-nitroindazole-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-4-nitroindazole-1-carboxylate |
|---|---|
| PubChem CID | 23134605 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | tert-butyl 5-[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]-4-nitroindazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(-c2ccc3c(cnn3C(=O)OC(C)(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H28N4O6/c1-23(2,3)33-21(29)25-13-15-7-9-16(10-8-15)17-11-12-19-18(20(17)28(31)32)14-26-27(19)22(30)34-24(4,5)6/h7-12,14H,13H2,1-6H3,(H,25,29) |
| InChIKey | VGDRJQULRTZAIZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|