C24H27N5O5S — CID 172631902
tert-butyl 4-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-nitroindazole-1-carboxylate (PubChem CID 172631902) has the molecular formula C24H27N5O5S and a molecular weight of 497.58 g/mol. Its IUPAC name is tert-butyl 4-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-nitroindazole-1-carboxylate.
| Compound Name | tert-butyl 4-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-nitroindazole-1-carboxylate |
|---|---|
| PubChem CID | 172631902 |
| Molecular Formula | C24H27N5O5S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | tert-butyl 4-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-nitroindazole-1-carboxylate |
| SMILES | COc1cc2ncc(-c3cc([N+](=O)[O-])cc4c3cnn4C(=O)OC(C)(C)C)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C24H27N5O5S/c1-23(2,3)34-22(30)28-17-9-14(29(31)32)8-15(16(17)11-26-28)18-12-25-21-10-19(33-7)20(13-27(18)21)35-24(4,5)6/h8-13H,1-7H3 |
| InChIKey | CPQOIVDZOSKRFU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|