C22H26FN3O3S2 — CID 178093970
5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxy-N-(oxetan-3-ylsulfanyl)aniline (PubChem CID 178093970) has the molecular formula C22H26FN3O3S2 and a molecular weight of 463.60 g/mol. Its IUPAC name is 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxy-N-(oxetan-3-ylsulfanyl)aniline.
| Compound Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxy-N-(oxetan-3-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 178093970 |
| Molecular Formula | C22H26FN3O3S2 |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-3-fluoro-2-methoxy-N-(oxetan-3-ylsulfanyl)aniline |
| SMILES | COc1cc2ncc(-c3cc(F)c(OC)c(NSC4COC4)c3)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C22H26FN3O3S2/c1-22(2,3)30-19-10-26-17(9-24-20(26)8-18(19)27-4)13-6-15(23)21(28-5)16(7-13)25-31-14-11-29-12-14/h6-10,14,25H,11-12H2,1-5H3 |
| InChIKey | SVSQIAPGWAFYGM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|