C18H20FN3OS — CID 170616433
3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-5-fluoroaniline (PubChem CID 170616433) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-5-fluoroaniline.
| Compound Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 170616433 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-5-fluoroaniline |
| SMILES | COc1cc2ncc(-c3cc(N)cc(F)c3)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C18H20FN3OS/c1-18(2,3)24-16-10-22-14(9-21-17(22)8-15(16)23-4)11-5-12(19)7-13(20)6-11/h5-10H,20H2,1-4H3 |
| InChIKey | FIVGZPZKUAHANH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|