C14H11F2N3O2 — CID 170616530
[3-(2,6-difluoro-4-pyridinyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]methanol (PubChem CID 170616530) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is [3-(2,6-difluoro-4-pyridinyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]methanol.
| Compound Name | [3-(2,6-difluoro-4-pyridinyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 170616530 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | [3-(2,6-difluoro-4-pyridinyl)-7-methoxyimidazo[1,2-a]pyridin-6-yl]methanol |
| SMILES | COc1cc2ncc(-c3cc(F)nc(F)c3)n2cc1CO |
| InChI | InChI=1S/C14H11F2N3O2/c1-21-11-4-14-17-5-10(19(14)6-9(11)7-20)8-2-12(15)18-13(16)3-8/h2-6,20H,7H2,1H3 |
| InChIKey | KIUCYVZBRPUQNW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|