C23H30FN5O3S — CID 170434784
4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine (PubChem CID 170434784) has the molecular formula C23H30FN5O3S and a molecular weight of 475.59 g/mol. Its IUPAC name is 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine.
| Compound Name | 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170434784 |
| Molecular Formula | C23H30FN5O3S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 4-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-N-(piperidin-4-ylmethyl)pyridin-2-amine |
| SMILES | COc1cc2ncc(-c3cc(F)nc(NCC4CCNCC4)c3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C23H30FN5O3S/c1-23(2,3)33(30,31)19-14-29-17(13-27-22(29)11-18(19)32-4)16-9-20(24)28-21(10-16)26-12-15-5-7-25-8-6-15/h9-11,13-15,25H,5-8,12H2,1-4H3,(H,26,28) |
| InChIKey | TXDDAKGYZSGBMR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|