C18H20FN3O3S — CID 172631556
3-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoroaniline (PubChem CID 172631556) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoroaniline.
| Compound Name | 3-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoroaniline |
|---|---|
| PubChem CID | 172631556 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoroaniline |
| SMILES | COc1cc2ncc(-c3cccc(N)c3F)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C18H20FN3O3S/c1-18(2,3)26(23,24)15-10-22-13(9-21-16(22)8-14(15)25-4)11-6-5-7-12(20)17(11)19/h5-10H,20H2,1-4H3 |
| InChIKey | FNYSGEMOWCZXIN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|