C21H25FN4O4S — CID 170616500
4-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-2-pyridinyl]morpholine (PubChem CID 170616500) has the molecular formula C21H25FN4O4S and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-2-pyridinyl]morpholine.
| Compound Name | 4-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 170616500 |
| Molecular Formula | C21H25FN4O4S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-6-fluoro-2-pyridinyl]morpholine |
| SMILES | COc1cc2ncc(-c3ccc(N4CCOCC4)nc3F)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C21H25FN4O4S/c1-21(2,3)31(27,28)17-13-26-15(12-23-19(26)11-16(17)29-4)14-5-6-18(24-20(14)22)25-7-9-30-10-8-25/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | IPSSERRSGYUKHH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|