C19H20F3N3O6S2 — CID 170616439
6-tert-butylsulfonyl-7-methoxy-3-[3-(sulfinoamino)-4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridine (PubChem CID 170616439) has the molecular formula C19H20F3N3O6S2 and a molecular weight of 507.51 g/mol. Its IUPAC name is 6-tert-butylsulfonyl-7-methoxy-3-[3-(sulfinoamino)-4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-tert-butylsulfonyl-7-methoxy-3-[3-(sulfinoamino)-4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 170616439 |
| Molecular Formula | C19H20F3N3O6S2 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | 6-tert-butylsulfonyl-7-methoxy-3-[3-(sulfinoamino)-4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridine |
| SMILES | COc1cc2ncc(-c3ccc(OC(F)(F)F)c(NS(=O)O)c3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C19H20F3N3O6S2/c1-18(2,3)33(28,29)16-10-25-13(9-23-17(25)8-15(16)30-4)11-5-6-14(31-19(20,21)22)12(7-11)24-32(26)27/h5-10,24H,1-4H3,(H,26,27) |
| InChIKey | KISVPYFIEXLOJP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|