C23H31N3O5S — CID 170434857
3-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-methoxy-3-methylanilino]propan-1-ol (PubChem CID 170434857) has the molecular formula C23H31N3O5S and a molecular weight of 461.58 g/mol. Its IUPAC name is 3-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-methoxy-3-methylanilino]propan-1-ol.
| Compound Name | 3-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-methoxy-3-methylanilino]propan-1-ol |
|---|---|
| PubChem CID | 170434857 |
| Molecular Formula | C23H31N3O5S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-[5-(6-tert-butylsulfonyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-methoxy-3-methylanilino]propan-1-ol |
| SMILES | COc1cc2ncc(-c3cc(C)c(OC)c(NCCCO)c3)n2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C23H31N3O5S/c1-15-10-16(11-17(22(15)31-6)24-8-7-9-27)18-13-25-21-12-19(30-5)20(14-26(18)21)32(28,29)23(2,3)4/h10-14,24,27H,7-9H2,1-6H3 |
| InChIKey | HKVRGWUZBBSRHL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|