C19H22FN3OS — CID 170616490
5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoro-3-methylaniline (PubChem CID 170616490) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoro-3-methylaniline.
| Compound Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoro-3-methylaniline |
|---|---|
| PubChem CID | 170616490 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-2-fluoro-3-methylaniline |
| SMILES | COc1cc2ncc(-c3cc(C)c(F)c(N)c3)n2cc1SC(C)(C)C |
| InChI | InChI=1S/C19H22FN3OS/c1-11-6-12(7-13(21)18(11)20)14-9-22-17-8-15(24-5)16(10-23(14)17)25-19(2,3)4/h6-10H,21H2,1-5H3 |
| InChIKey | DJLNPTSQPUUIMK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|