C25H32FN3O2S2 — CID 178093965
5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-N-[(E)-cyclobutyl(ethylidene)-λ4-sulfanyl]-3-fluoro-2-methoxyaniline (PubChem CID 178093965) has the molecular formula C25H32FN3O2S2 and a molecular weight of 489.68 g/mol. Its IUPAC name is 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-N-[(E)-cyclobutyl(ethylidene)-λ4-sulfanyl]-3-fluoro-2-methoxyaniline.
| Compound Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-N-[(E)-cyclobutyl(ethylidene)-λ4-sulfanyl]-3-fluoro-2-methoxyaniline |
|---|---|
| PubChem CID | 178093965 |
| Molecular Formula | C25H32FN3O2S2 |
| Molecular Weight | 489.68 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 5-(6-tert-butylsulfanyl-7-methoxyimidazo[1,2-a]pyridin-3-yl)-N-[(E)-cyclobutyl(ethylidene)-λ4-sulfanyl]-3-fluoro-2-methoxyaniline |
| SMILES | C/C=S(/Nc1cc(-c2cnc3cc(OC)c(SC(C)(C)C)cn23)cc(F)c1OC)C1CCC1 |
| InChI | InChI=1S/C25H32FN3O2S2/c1-7-33(17-9-8-10-17)28-19-12-16(11-18(26)24(19)31-6)20-14-27-23-13-21(30-5)22(15-29(20)23)32-25(2,3)4/h7,11-15,17,28H,8-10H2,1-6H3 |
| InChIKey | GDZGZLUEHJPCLF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 47.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|