C26H36FN5O5S2 — CID 178094073
(2S)-1-[6-tert-butylsulfonyl-3-[3-[[ethylidene-[(2Z)-2-(methylhydrazinylidene)ethyl]-λ4-sulfanyl]amino]-5-fluoro-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]oxypropan-2-ol (PubChem CID 178094073) has the molecular formula C26H36FN5O5S2 and a molecular weight of 581.74 g/mol. Its IUPAC name is (2S)-1-[6-tert-butylsulfonyl-3-[3-[[ethylidene-[(2Z)-2-(methylhydrazinylidene)ethyl]-λ4-sulfanyl]amino]-5-fluoro-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]oxypropan-2-ol.
| Compound Name | (2S)-1-[6-tert-butylsulfonyl-3-[3-[[ethylidene-[(2Z)-2-(methylhydrazinylidene)ethyl]-λ4-sulfanyl]amino]-5-fluoro-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]oxypropan-2-ol |
|---|---|
| PubChem CID | 178094073 |
| Molecular Formula | C26H36FN5O5S2 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | (2S)-1-[6-tert-butylsulfonyl-3-[3-[[ethylidene-[(2Z)-2-(methylhydrazinylidene)ethyl]-λ4-sulfanyl]amino]-5-fluoro-4-methoxyphenyl]imidazo[1,2-a]pyridin-7-yl]oxypropan-2-ol |
| SMILES | CC=S(C/C=N\NC)Nc1cc(-c2cnc3cc(OC[C@H](C)O)c(S(=O)(=O)C(C)(C)C)cn23)cc(F)c1OC |
| InChI | InChI=1S/C26H36FN5O5S2/c1-8-38(10-9-30-28-6)31-20-12-18(11-19(27)25(20)36-7)21-14-29-24-13-22(37-16-17(2)33)23(15-32(21)24)39(34,35)26(3,4)5/h8-9,11-15,17,28,31,33H,10,16H2,1-7H3/b30-9-/t17-,38?/m0/s1 |
| InChIKey | BYJVYTACQAAEPA-DEWOQBTNSA-N |
| XLogP | 4.10 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|