About 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen
2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen (PubChem CID 158822565) has the molecular formula C11H11ClF3NO3S
and a molecular weight of 329.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen |
| PubChem CID | 158822565 |
| Molecular Formula | C11H11ClF3NO3S |
| Molecular Weight | 329.73 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen |
| SMILES | NC(=O)C(SCCC(F)(F)F)c1ccc(Cl)cc1.O=O |
| InChI | InChI=1S/C11H11ClF3NOS.O2/c12-8-3-1-7(2-4-8)9(10(16)17)18-6-5-11(13,14)15;1-2/h1-4,9H,5-6H2,(H2,16,17); |
| InChIKey | IWBDLUZVGKZRGX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen?
The IUPAC name of 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen (CID 158822565) is 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen.
What is the SMILES notation for 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen?
The canonical SMILES for 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen is NC(=O)C(SCCC(F)(F)F)c1ccc(Cl)cc1.O=O.
What is the InChIKey of 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen?
The InChIKey is IWBDLUZVGKZRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF3NOS.O2/c12-8-3-1-7(2-4-8)9(10(16)17)18-6-5-11(13,14)15;1-2/h1-4,9H,5-6H2,(H2,16,17);.
What are the key properties of 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen?
2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen has a molecular weight of 329.73 g/mol, XLogP of 3.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-2-(3,3,3-trifluoropropylsulfanyl)acetamide;molecular oxygen is sourced from PubChem (CID 158822565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).