C16H33NO — CID 158823393
(2S,6R)-2,4,6-trimethyloxane;(3S,5R)-1,3,5-trimethylpiperidine (PubChem CID 158823393) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is (2S,6R)-2,4,6-trimethyloxane;(3S,5R)-1,3,5-trimethylpiperidine.
| Compound Name | (2S,6R)-2,4,6-trimethyloxane;(3S,5R)-1,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 158823393 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | (2S,6R)-2,4,6-trimethyloxane;(3S,5R)-1,3,5-trimethylpiperidine |
| SMILES | CC1C[C@@H](C)O[C@@H](C)C1.C[C@@H]1C[C@H](C)CN(C)C1 |
| InChI | InChI=1S/C8H17N.C8H16O/c1-7-4-8(2)6-9(3)5-7;1-6-4-7(2)9-8(3)5-6/h7-8H,4-6H2,1-3H3;6-8H,4-5H2,1-3H3/t7-,8+;6?,7-,8+ |
| InChIKey | IWDPKOCHWUYLEV-VHXXEBRASA-N |
| XLogP | 3.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |