About 3-propanoyloxypropane-1-sulfonate;rubidium(1+)
3-propanoyloxypropane-1-sulfonate;rubidium(1+) (PubChem CID 158823574) has the molecular formula C6H11O5RbS
and a molecular weight of 280.68 g/mol. Its IUPAC name is 3-propanoyloxypropane-1-sulfonate;rubidium(1+).
Molecular Properties
| Compound Name | 3-propanoyloxypropane-1-sulfonate;rubidium(1+) |
| PubChem CID | 158823574 |
| Molecular Formula | C6H11O5RbS |
| Molecular Weight | 280.68 g/mol |
| Exact Mass | 279.94 |
| IUPAC Name | 3-propanoyloxypropane-1-sulfonate;rubidium(1+) |
| SMILES | CCC(=O)OCCCS(=O)(=O)[O-].[Rb+] |
| InChI | InChI=1S/C6H12O5S.Rb/c1-2-6(7)11-4-3-5-12(8,9)10;/h2-5H2,1H3,(H,8,9,10);/q;+1/p-1 |
| InChIKey | IWEDLEAUZGTEQJ-UHFFFAOYSA-M |
| XLogP | -3.12 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.68 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-propanoyloxypropane-1-sulfonate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propanoyloxypropane-1-sulfonate;rubidium(1+)?
The IUPAC name of 3-propanoyloxypropane-1-sulfonate;rubidium(1+) (CID 158823574) is 3-propanoyloxypropane-1-sulfonate;rubidium(1+).
What is the SMILES notation for 3-propanoyloxypropane-1-sulfonate;rubidium(1+)?
The canonical SMILES for 3-propanoyloxypropane-1-sulfonate;rubidium(1+) is CCC(=O)OCCCS(=O)(=O)[O-].[Rb+].
What is the InChIKey of 3-propanoyloxypropane-1-sulfonate;rubidium(1+)?
The InChIKey is IWEDLEAUZGTEQJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O5S.Rb/c1-2-6(7)11-4-3-5-12(8,9)10;/h2-5H2,1H3,(H,8,9,10);/q;+1/p-1.
What are the key properties of 3-propanoyloxypropane-1-sulfonate;rubidium(1+)?
3-propanoyloxypropane-1-sulfonate;rubidium(1+) has a molecular weight of 280.68 g/mol, XLogP of -3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propanoyloxypropane-1-sulfonate;rubidium(1+) is sourced from PubChem (CID 158823574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).