C38H47F3N4O4 — CID 158824523
(2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-[6-(trifluoromethyl)pyridine-3-carbonyl]undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide (PubChem CID 158824523) has the molecular formula C38H47F3N4O4 and a molecular weight of 680.81 g/mol. Its IUPAC name is (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-[6-(trifluoromethyl)pyridine-3-carbonyl]undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide.
| Compound Name | (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-[6-(trifluoromethyl)pyridine-3-carbonyl]undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 158824523 |
| Molecular Formula | C38H47F3N4O4 |
| Molecular Weight | 680.81 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-[6-(trifluoromethyl)pyridine-3-carbonyl]undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](CC(=O)[C@H](N)Cc1ccccc1)Cc1ccccc1)C(=O)C[C@H](CCCCN)C(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C38H47F3N4O4/c1-25(2)19-32(34(47)22-28(15-9-10-18-42)36(48)29-16-17-35(44-24-29)38(39,40)41)45-37(49)30(20-26-11-5-3-6-12-26)23-33(46)31(43)21-27-13-7-4-8-14-27/h3-8,11-14,16-17,24-25,28,30-32H,9-10,15,18-23,42-43H2,1-2H3,(H,45,49)/t28-,30-,31+,32+/m0/s1 |
| InChIKey | HXVLWGMUNYUBEU-JSSJSZTNSA-N |
| XLogP | 5.91 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.81 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|