C40H55N7O4 — CID 58265269
(2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-(4-pyrazin-2-ylpiperazine-1-carbonyl)undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide (PubChem CID 58265269) has the molecular formula C40H55N7O4 and a molecular weight of 697.93 g/mol. Its IUPAC name is (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-(4-pyrazin-2-ylpiperazine-1-carbonyl)undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide.
| Compound Name | (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-(4-pyrazin-2-ylpiperazine-1-carbonyl)undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide |
|---|---|
| PubChem CID | 58265269 |
| Molecular Formula | C40H55N7O4 |
| Molecular Weight | 697.93 g/mol |
| Exact Mass | 697.43 |
| IUPAC Name | (2S,5R)-5-amino-N-[(4R,7S)-11-amino-2-methyl-5-oxo-7-(4-pyrazin-2-ylpiperazine-1-carbonyl)undecan-4-yl]-2-benzyl-4-oxo-6-phenylhexanamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](CC(=O)[C@H](N)Cc1ccccc1)Cc1ccccc1)C(=O)C[C@H](CCCCN)C(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C40H55N7O4/c1-29(2)23-35(37(49)26-32(15-9-10-16-41)40(51)47-21-19-46(20-22-47)38-28-43-17-18-44-38)45-39(50)33(24-30-11-5-3-6-12-30)27-36(48)34(42)25-31-13-7-4-8-14-31/h3-8,11-14,17-18,28-29,32-35H,9-10,15-16,19-27,41-42H2,1-2H3,(H,45,50)/t32-,33-,34+,35+/m0/s1 |
| InChIKey | MKBCQGVRVFJCAZ-NUXXNWGHSA-N |
| XLogP | 3.75 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.93 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|