C20H25ClN2O4 — CID 158825351
[2-chloro-5-[C-methyl-N-[(3-methylphenyl)methoxy]carbonimidoyl]phenyl]methylcarbamic acid;methoxymethane (PubChem CID 158825351) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is [2-chloro-5-[C-methyl-N-[(3-methylphenyl)methoxy]carbonimidoyl]phenyl]methylcarbamic acid;methoxymethane.
| Compound Name | [2-chloro-5-[C-methyl-N-[(3-methylphenyl)methoxy]carbonimidoyl]phenyl]methylcarbamic acid;methoxymethane |
|---|---|
| PubChem CID | 158825351 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [2-chloro-5-[C-methyl-N-[(3-methylphenyl)methoxy]carbonimidoyl]phenyl]methylcarbamic acid;methoxymethane |
| SMILES | CC(=NOCc1cccc(C)c1)c1ccc(Cl)c(CNC(=O)O)c1.COC |
| InChI | InChI=1S/C18H19ClN2O3.C2H6O/c1-12-4-3-5-14(8-12)11-24-21-13(2)15-6-7-17(19)16(9-15)10-20-18(22)23;1-3-2/h3-9,20H,10-11H2,1-2H3,(H,22,23);1-2H3 |
| InChIKey | IWJSUUZUCAQRAS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|