C39H28Cl2N8O3 — CID 158826508
5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carbohydrazide;methyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carboxylate (PubChem CID 158826508) has the molecular formula C39H28Cl2N8O3 and a molecular weight of 727.61 g/mol. Its IUPAC name is 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carbohydrazide;methyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carboxylate.
| Compound Name | 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carbohydrazide;methyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 158826508 |
| Molecular Formula | C39H28Cl2N8O3 |
| Molecular Weight | 727.61 g/mol |
| Exact Mass | 726.17 |
| IUPAC Name | 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carbohydrazide;methyl 5-(3-chloroanilino)benzo[c][2,6]naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12.NNC(=O)c1cccc2c1nc(Nc1cccc(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C20H14ClN3O2.C19H14ClN5O/c1-26-20(25)16-7-3-6-14-17-11-22-9-8-15(17)19(24-18(14)16)23-13-5-2-4-12(21)10-13;20-11-3-1-4-12(9-11)23-18-14-7-8-22-10-16(14)13-5-2-6-15(17(13)24-18)19(26)25-21/h2-11H,1H3,(H,23,24);1-10H,21H2,(H,23,24)(H,25,26) |
| InChIKey | IWNFEHAJZVNLPO-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 157.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.61 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|