C18H18F2N2S — CID 158833307
2,2-difluoroethyl-methylidene-[4-methyl-3-(4H-quinazolin-3-yl)phenyl]-λ4-sulfane (PubChem CID 158833307) has the molecular formula C18H18F2N2S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2,2-difluoroethyl-methylidene-[4-methyl-3-(4H-quinazolin-3-yl)phenyl]-λ4-sulfane.
| Compound Name | 2,2-difluoroethyl-methylidene-[4-methyl-3-(4H-quinazolin-3-yl)phenyl]-λ4-sulfane |
|---|---|
| PubChem CID | 158833307 |
| Molecular Formula | C18H18F2N2S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2,2-difluoroethyl-methylidene-[4-methyl-3-(4H-quinazolin-3-yl)phenyl]-λ4-sulfane |
| SMILES | C=S(CC(F)F)c1ccc(C)c(N2C=Nc3ccccc3C2)c1 |
| InChI | InChI=1S/C18H18F2N2S/c1-13-7-8-15(23(2)11-18(19)20)9-17(13)22-10-14-5-3-4-6-16(14)21-12-22/h3-9,12,18H,2,10-11H2,1H3 |
| InChIKey | FOWKNBCRZMFHDM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|