C13H13N3O2 — CID 90891190
1-methyl-3-(4H-quinazolin-3-yl)pyrrole-2,5-diol (PubChem CID 90891190) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 1-methyl-3-(4H-quinazolin-3-yl)pyrrole-2,5-diol.
| Compound Name | 1-methyl-3-(4H-quinazolin-3-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 90891190 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 1-methyl-3-(4H-quinazolin-3-yl)pyrrole-2,5-diol |
| SMILES | Cn1c(O)cc(N2C=Nc3ccccc3C2)c1O |
| InChI | InChI=1S/C13H13N3O2/c1-15-12(17)6-11(13(15)18)16-7-9-4-2-3-5-10(9)14-8-16/h2-6,8,17-18H,7H2,1H3 |
| InChIKey | SCGIISIWMDJCSO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |