About (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate
(5-oxo-2H-furan-4-yl) trifluoromethanesulfonate (PubChem CID 15883473) has the molecular formula C5H3F3O5S
and a molecular weight of 232.13 g/mol. Its IUPAC name is (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate |
| PubChem CID | 15883473 |
| Molecular Formula | C5H3F3O5S |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate |
| SMILES | O=C1OCC=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C5H3F3O5S/c6-5(7,8)14(10,11)13-3-1-2-12-4(3)9/h1H,2H2 |
| InChIKey | DUFOYHKHMDCIHL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate?
The IUPAC name of (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate (CID 15883473) is (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate.
What is the SMILES notation for (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate?
The canonical SMILES for (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate is O=C1OCC=C1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate?
The InChIKey is DUFOYHKHMDCIHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3O5S/c6-5(7,8)14(10,11)13-3-1-2-12-4(3)9/h1H,2H2.
What are the key properties of (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate?
(5-oxo-2H-furan-4-yl) trifluoromethanesulfonate has a molecular weight of 232.13 g/mol, XLogP of 0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-2H-furan-4-yl) trifluoromethanesulfonate is sourced from PubChem (CID 15883473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).