C9H7F3O7S — CID 11438464
ethyl (2E)-2-[5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate (PubChem CID 11438464) has the molecular formula C9H7F3O7S and a molecular weight of 316.21 g/mol. Its IUPAC name is ethyl (2E)-2-[5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate |
|---|---|
| PubChem CID | 11438464 |
| Molecular Formula | C9H7F3O7S |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | ethyl (2E)-2-[5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\C=C(OS(=O)(=O)C(F)(F)F)C(=O)O1 |
| InChI | InChI=1S/C9H7F3O7S/c1-2-17-7(13)4-5-3-6(8(14)18-5)19-20(15,16)9(10,11)12/h3-4H,2H2,1H3/b5-4+ |
| InChIKey | IYVXJJRVXCMYKD-SNAWJCMRSA-N |
| XLogP | 0.74 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|