C10H9F3O7S — CID 101396517
[(5Z)-4-ethoxy-2-oxo-5-(2-oxopropylidene)furan-3-yl] trifluoromethanesulfonate (PubChem CID 101396517) has the molecular formula C10H9F3O7S and a molecular weight of 330.24 g/mol. Its IUPAC name is [(5Z)-4-ethoxy-2-oxo-5-(2-oxopropylidene)furan-3-yl] trifluoromethanesulfonate.
| Compound Name | [(5Z)-4-ethoxy-2-oxo-5-(2-oxopropylidene)furan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101396517 |
| Molecular Formula | C10H9F3O7S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | [(5Z)-4-ethoxy-2-oxo-5-(2-oxopropylidene)furan-3-yl] trifluoromethanesulfonate |
| SMILES | CCOC1=C(OS(=O)(=O)C(F)(F)F)C(=O)O/C1=C\C(C)=O |
| InChI | InChI=1S/C10H9F3O7S/c1-3-18-7-6(4-5(2)14)19-9(15)8(7)20-21(16,17)10(11,12)13/h4H,3H2,1-2H3/b6-4- |
| InChIKey | MKWRLKXMZKHKOC-XQRVVYSFSA-N |
| XLogP | 1.13 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|