C11H11F3O8S — CID 11681989
ethyl (2Z)-2-[3-ethoxy-5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate (PubChem CID 11681989) has the molecular formula C11H11F3O8S and a molecular weight of 360.26 g/mol. Its IUPAC name is ethyl (2Z)-2-[3-ethoxy-5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[3-ethoxy-5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate |
|---|---|
| PubChem CID | 11681989 |
| Molecular Formula | C11H11F3O8S |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | ethyl (2Z)-2-[3-ethoxy-5-oxo-4-(trifluoromethylsulfonyloxy)furan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\OC(=O)C(OS(=O)(=O)C(F)(F)F)=C1OCC |
| InChI | InChI=1S/C11H11F3O8S/c1-3-19-7(15)5-6-8(20-4-2)9(10(16)21-6)22-23(17,18)11(12,13)14/h5H,3-4H2,1-2H3/b6-5- |
| InChIKey | DZGWIVPMRIRZOD-WAYWQWQTSA-N |
| XLogP | 1.10 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|