C22H23ClN2O — CID 158836321
1-(2-chlorophenyl)-7-cyclopropyl-4-pentylquinazolin-2-one (PubChem CID 158836321) has the molecular formula C22H23ClN2O and a molecular weight of 366.89 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-7-cyclopropyl-4-pentylquinazolin-2-one.
| Compound Name | 1-(2-chlorophenyl)-7-cyclopropyl-4-pentylquinazolin-2-one |
|---|---|
| PubChem CID | 158836321 |
| Molecular Formula | C22H23ClN2O |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-(2-chlorophenyl)-7-cyclopropyl-4-pentylquinazolin-2-one |
| SMILES | CCCCCc1nc(=O)n(-c2ccccc2Cl)c2cc(C3CC3)ccc12 |
| InChI | InChI=1S/C22H23ClN2O/c1-2-3-4-8-19-17-13-12-16(15-10-11-15)14-21(17)25(22(26)24-19)20-9-6-5-7-18(20)23/h5-7,9,12-15H,2-4,8,10-11H2,1H3 |
| InChIKey | IXRKZKQOUFAAJC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|