C21H18ClN3O — CID 175429137
4-[(2R)-2-aminobut-3-ynyl]-1-(2-chlorophenyl)-7-cyclopropylquinazolin-2-one (PubChem CID 175429137) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 4-[(2R)-2-aminobut-3-ynyl]-1-(2-chlorophenyl)-7-cyclopropylquinazolin-2-one.
| Compound Name | 4-[(2R)-2-aminobut-3-ynyl]-1-(2-chlorophenyl)-7-cyclopropylquinazolin-2-one |
|---|---|
| PubChem CID | 175429137 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 4-[(2R)-2-aminobut-3-ynyl]-1-(2-chlorophenyl)-7-cyclopropylquinazolin-2-one |
| SMILES | C#C[C@H](N)Cc1nc(=O)n(-c2ccccc2Cl)c2cc(C3CC3)ccc12 |
| InChI | InChI=1S/C21H18ClN3O/c1-2-15(23)12-18-16-10-9-14(13-7-8-13)11-20(16)25(21(26)24-18)19-6-4-3-5-17(19)22/h1,3-6,9-11,13,15H,7-8,12,23H2/t15-/m0/s1 |
| InChIKey | KKCSDCPYBMUNHW-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|