C24H29Cl2FN3O7S2- — CID 158836800
acetic acid;5-cyclopropyl-4-[[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-2-fluorobenzamide;methanesulfinate (PubChem CID 158836800) has the molecular formula C24H29Cl2FN3O7S2- and a molecular weight of 625.55 g/mol. Its IUPAC name is acetic acid;5-cyclopropyl-4-[[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-2-fluorobenzamide;methanesulfinate.
| Compound Name | acetic acid;5-cyclopropyl-4-[[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-2-fluorobenzamide;methanesulfinate |
|---|---|
| PubChem CID | 158836800 |
| Molecular Formula | C24H29Cl2FN3O7S2- |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | acetic acid;5-cyclopropyl-4-[[4-(3,5-dichlorophenyl)sulfonylpiperazin-1-yl]methyl]-2-fluorobenzamide;methanesulfinate |
| SMILES | CC(=O)O.CS(=O)[O-].NC(=O)c1cc(C2CC2)c(CN2CCN(S(=O)(=O)c3cc(Cl)cc(Cl)c3)CC2)cc1F |
| InChI | InChI=1S/C21H22Cl2FN3O3S.C2H4O2.CH4O2S/c22-15-8-16(23)10-17(9-15)31(29,30)27-5-3-26(4-6-27)12-14-7-20(24)19(21(25)28)11-18(14)13-1-2-13;1-2(3)4;1-4(2)3/h7-11,13H,1-6,12H2,(H2,25,28);1H3,(H,3,4);1H3,(H,2,3)/p-1 |
| InChIKey | ZXGAZGAAKIZNAE-UHFFFAOYSA-M |
| XLogP | 3.20 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|