C23H21BBr2F6N3O5 — CID 158838022
CID 158838022 (PubChem CID 158838022) has the molecular formula C23H21BBr2F6N3O5 and a molecular weight of 704.05 g/mol.
| Compound Name | CID 158838022 |
|---|---|
| PubChem CID | 158838022 |
| Molecular Formula | C23H21BBr2F6N3O5 |
| Molecular Weight | 704.05 g/mol |
| Exact Mass | 701.98 |
| IUPAC Name | — |
| SMILES | CC(=O)c1cncc(Br)c1.CC(O)(c1cncc(Br)c1)C(F)(F)F.CC(O)(c1cncc(O[B]O)c1)C(F)(F)F |
| InChI | InChI=1S/C8H8BF3NO3.C8H7BrF3NO.C7H6BrNO/c1-7(14,8(10,11)12)5-2-6(16-9-15)4-13-3-5;1-7(14,8(10,11)12)5-2-6(9)4-13-3-5;1-5(10)6-2-7(8)4-9-3-6/h2-4,14-15H,1H3;2-4,14H,1H3;2-4H,1H3 |
| InChIKey | OQTHSQWDMKVCPU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|