C39H40FN5O — CID 158838189
(4S,5S)-4-[1-[3-[9-(4-fluoro-2-pyridinyl)carbazol-2-yl]oxy-5-methylphenyl]-3,5-dimethylpyrazol-4-yl]-N,N,3,5-tetramethylcyclohex-2-en-1-amine (PubChem CID 158838189) has the molecular formula C39H40FN5O and a molecular weight of 613.78 g/mol. Its IUPAC name is (4S,5S)-4-[1-[3-[9-(4-fluoro-2-pyridinyl)carbazol-2-yl]oxy-5-methylphenyl]-3,5-dimethylpyrazol-4-yl]-N,N,3,5-tetramethylcyclohex-2-en-1-amine.
| Compound Name | (4S,5S)-4-[1-[3-[9-(4-fluoro-2-pyridinyl)carbazol-2-yl]oxy-5-methylphenyl]-3,5-dimethylpyrazol-4-yl]-N,N,3,5-tetramethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 158838189 |
| Molecular Formula | C39H40FN5O |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | (4S,5S)-4-[1-[3-[9-(4-fluoro-2-pyridinyl)carbazol-2-yl]oxy-5-methylphenyl]-3,5-dimethylpyrazol-4-yl]-N,N,3,5-tetramethylcyclohex-2-en-1-amine |
| SMILES | CC1=CC(N(C)C)C[C@H](C)[C@@H]1c1c(C)nn(-c2cc(C)cc(Oc3ccc4c5ccccc5n(-c5cc(F)ccn5)c4c3)c2)c1C |
| InChI | InChI=1S/C39H40FN5O/c1-23-16-30(45-27(5)39(26(4)42-45)38-24(2)18-29(43(6)7)19-25(38)3)21-32(17-23)46-31-12-13-34-33-10-8-9-11-35(33)44(36(34)22-31)37-20-28(40)14-15-41-37/h8-18,20-22,25,29,38H,19H2,1-7H3/t25-,29?,38+/m0/s1 |
| InChIKey | FWGZUFUEBBANKN-BDOPKZDMSA-N |
| XLogP | 9.22 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|