C34H26BBrN3S — CID 158843090
CID 158843090 (PubChem CID 158843090) has the molecular formula C34H26BBrN3S and a molecular weight of 599.39 g/mol.
| Compound Name | CID 158843090 |
|---|---|
| PubChem CID | 158843090 |
| Molecular Formula | C34H26BBrN3S |
| Molecular Weight | 599.39 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | — |
| SMILES | Cn1c2ccc(Br)cc2c2c3ccccc3ccc21.Cn1c2ccccc2c2c3ccccc3ccc21.[B]=NS |
| InChI | InChI=1S/C17H12BrN.C17H13N.BHNS/c1-19-15-9-7-12(18)10-14(15)17-13-5-3-2-4-11(13)6-8-16(17)19;1-18-15-9-5-4-8-14(15)17-13-7-3-2-6-12(13)10-11-16(17)18;1-2-3/h2-10H,1H3;2-11H,1H3;3H |
| InChIKey | ZDFOFDCDQAXIBZ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 22.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.39 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|