C28H29N3O — CID 158846169
5-ethoxy-3-[3-[4-[(2-methyl-3H-inden-5-yl)methyl]pyrimidin-2-yl]propyl]-1H-indole (PubChem CID 158846169) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is 5-ethoxy-3-[3-[4-[(2-methyl-3H-inden-5-yl)methyl]pyrimidin-2-yl]propyl]-1H-indole.
| Compound Name | 5-ethoxy-3-[3-[4-[(2-methyl-3H-inden-5-yl)methyl]pyrimidin-2-yl]propyl]-1H-indole |
|---|---|
| PubChem CID | 158846169 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 5-ethoxy-3-[3-[4-[(2-methyl-3H-inden-5-yl)methyl]pyrimidin-2-yl]propyl]-1H-indole |
| SMILES | CCOc1ccc2[nH]cc(CCCc3nccc(Cc4ccc5c(c4)CC(C)=C5)n3)c2c1 |
| InChI | InChI=1S/C28H29N3O/c1-3-32-25-9-10-27-26(17-25)22(18-30-27)5-4-6-28-29-12-11-24(31-28)16-20-7-8-21-13-19(2)14-23(21)15-20/h7-13,15,17-18,30H,3-6,14,16H2,1-2H3 |
| InChIKey | IYWBZAZTZPVTEK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |