C25H24N4O4 — CID 158847546
(3aS,8bR)-1-(2-hydroxyethyl)-5-[5-(2-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one (PubChem CID 158847546) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is (3aS,8bR)-1-(2-hydroxyethyl)-5-[5-(2-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one.
| Compound Name | (3aS,8bR)-1-(2-hydroxyethyl)-5-[5-(2-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
|---|---|
| PubChem CID | 158847546 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (3aS,8bR)-1-(2-hydroxyethyl)-5-[5-(2-isocyano-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-3,3a,4,8b-tetrahydroindeno[1,2-b]pyrrol-2-one |
| SMILES | [C-]#[N+]c1cc(OC(C)C)ccc1-c1nc(-c2cccc3c2C[C@H]2CC(=O)N(CCO)[C@@H]32)no1 |
| InChI | InChI=1S/C25H24N4O4/c1-14(2)32-16-7-8-19(21(13-16)26-3)25-27-24(28-33-25)18-6-4-5-17-20(18)11-15-12-22(31)29(9-10-30)23(15)17/h4-8,13-15,23,30H,9-12H2,1-2H3/t15-,23+/m0/s1 |
| InChIKey | HXIKQMBDOKROTA-NPMXOYFQSA-N |
| XLogP | 4.18 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|