C16H21F3N2O5S — CID 158849703
(4S)-6-methyl-3-oxo-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]heptane-1-sulfonic acid (PubChem CID 158849703) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is (4S)-6-methyl-3-oxo-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]heptane-1-sulfonic acid.
| Compound Name | (4S)-6-methyl-3-oxo-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]heptane-1-sulfonic acid |
|---|---|
| PubChem CID | 158849703 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (4S)-6-methyl-3-oxo-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]heptane-1-sulfonic acid |
| SMILES | CC(C)C[C@H](NC(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)CCS(=O)(=O)O |
| InChI | InChI=1S/C16H21F3N2O5S/c1-10(2)9-13(14(22)7-8-27(24,25)26)21-15(23)20-12-5-3-11(4-6-12)16(17,18)19/h3-6,10,13H,7-9H2,1-2H3,(H2,20,21,23)(H,24,25,26)/t13-/m0/s1 |
| InChIKey | IZHFBXNZUNCPGB-ZDUSSCGKSA-N |
| XLogP | 3.09 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|