C46H80N4O8Si6 — CID 158852445
bis[2-aminoethyl(dimethyl)silyl] dimethyl silicate;bis[5-aminopentyl(diphenyl)silyl] dimethyl silicate (PubChem CID 158852445) has the molecular formula C46H80N4O8Si6 and a molecular weight of 985.68 g/mol. Its IUPAC name is bis[2-aminoethyl(dimethyl)silyl] dimethyl silicate;bis[5-aminopentyl(diphenyl)silyl] dimethyl silicate.
| Compound Name | bis[2-aminoethyl(dimethyl)silyl] dimethyl silicate;bis[5-aminopentyl(diphenyl)silyl] dimethyl silicate |
|---|---|
| PubChem CID | 158852445 |
| Molecular Formula | C46H80N4O8Si6 |
| Molecular Weight | 985.68 g/mol |
| Exact Mass | 984.46 |
| IUPAC Name | bis[2-aminoethyl(dimethyl)silyl] dimethyl silicate;bis[5-aminopentyl(diphenyl)silyl] dimethyl silicate |
| SMILES | CO[Si](OC)(O[Si](C)(C)CCN)O[Si](C)(C)CCN.CO[Si](OC)(O[Si](CCCCCN)(c1ccccc1)c1ccccc1)O[Si](CCCCCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H50N2O4Si3.C10H30N2O4Si3/c1-39-45(40-2,41-43(31-19-7-17-29-37,33-21-9-3-10-22-33)34-23-11-4-12-24-34)42-44(32-20-8-18-30-38,35-25-13-5-14-26-35)36-27-15-6-16-28-36;1-13-19(14-2,15-17(3,4)9-7-11)16-18(5,6)10-8-12/h3-6,9-16,21-28H,7-8,17-20,29-32,37-38H2,1-2H3;7-12H2,1-6H3 |
| InChIKey | IZQAYGUKRYCSAB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 177.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|