C32H40N2OSi2 — CID 20608300
4-[[3-aminopropyl(diphenyl)silyl]methoxy-diphenylsilyl]butan-1-amine (PubChem CID 20608300) has the molecular formula C32H40N2OSi2 and a molecular weight of 524.86 g/mol. Its IUPAC name is 4-[[3-aminopropyl(diphenyl)silyl]methoxy-diphenylsilyl]butan-1-amine.
| Compound Name | 4-[[3-aminopropyl(diphenyl)silyl]methoxy-diphenylsilyl]butan-1-amine |
|---|---|
| PubChem CID | 20608300 |
| Molecular Formula | C32H40N2OSi2 |
| Molecular Weight | 524.86 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 4-[[3-aminopropyl(diphenyl)silyl]methoxy-diphenylsilyl]butan-1-amine |
| SMILES | NCCCC[Si](OC[Si](CCCN)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40N2OSi2/c33-24-13-14-27-37(31-20-9-3-10-21-31,32-22-11-4-12-23-32)35-28-36(26-15-25-34,29-16-5-1-6-17-29)30-18-7-2-8-19-30/h1-12,16-23H,13-15,24-28,33-34H2 |
| InChIKey | PBAWOJOMPHEFLY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.86 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|