C35H45NO2Si2 — CID 22242907
1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-amine (PubChem CID 22242907) has the molecular formula C35H45NO2Si2 and a molecular weight of 567.92 g/mol. Its IUPAC name is 1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-amine.
| Compound Name | 1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-amine |
|---|---|
| PubChem CID | 22242907 |
| Molecular Formula | C35H45NO2Si2 |
| Molecular Weight | 567.92 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 1,3-bis[[tert-butyl(diphenyl)silyl]oxy]propan-2-amine |
| SMILES | CC(C)(C)[Si](OCC(N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H45NO2Si2/c1-34(2,3)39(30-19-11-7-12-20-30,31-21-13-8-14-22-31)37-27-29(36)28-38-40(35(4,5)6,32-23-15-9-16-24-32)33-25-17-10-18-26-33/h7-26,29H,27-28,36H2,1-6H3 |
| InChIKey | MLULMCPKQYBQTM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|